CAS 88239-26-3
:Benzoic acid, 3-chloro-, bicyclo[4.2.1]non-6-en-1-yl ester
Description:
Benzoic acid, 3-chloro-, bicyclo[4.2.1]non-6-en-1-yl ester, identified by the CAS number 88239-26-3, is an organic compound characterized by its bicyclic structure and the presence of a chloro substituent. This compound features a benzoic acid moiety, which contributes to its acidity and potential reactivity. The bicyclo[4.2.1]nonene framework indicates a unique arrangement of carbon atoms that can influence its physical and chemical properties, such as stability and reactivity. The presence of the chloro group can enhance the compound's electrophilicity, making it useful in various chemical reactions, including nucleophilic substitutions. Additionally, the ester functional group suggests that this compound may exhibit properties typical of esters, such as volatility and solubility in organic solvents. Overall, the structural characteristics of this compound suggest potential applications in organic synthesis and materials science, although specific applications would depend on further research and exploration of its reactivity and interactions with other substances.
Formula:C16H17ClO2
InChI:InChI=1S/C16H17ClO2/c17-14-6-3-5-13(10-14)15(18)19-16-8-2-1-4-12(11-16)7-9-16/h3,5-7,10H,1-2,4,8-9,11H2
InChI key:QTTVBUOVIPYTQJ-UHFFFAOYSA-N
SMILES:C1CCC2(CC=C(C1)C2)OC(=O)C3=CC(=CC=C3)Cl
Filter by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
- Lower prices
- Higher prices
- Lower purities
- Higher purities
- Faster estimated delivery
Benzoic acid, 3-chloro-, bicyclo[4.2.1]non-6-en-1-yl ester
CAS:Formula:C16H17ClO2Molecular weight:276.758
