CAS 88239-39-8
:2-Butenoic acid, 4-bromo-, trimethylsilyl ester, (E)-
Description:
2-Butenoic acid, 4-bromo-, trimethylsilyl ester, (E)- is an organic compound characterized by its ester functional group, which is formed from the reaction of 2-butenoic acid and trimethylsilyl chloride in the presence of a base. This compound features a double bond in the butenoic acid moiety, specifically in the (E) configuration, indicating that the highest priority substituents on either end of the double bond are on opposite sides. The presence of a bromine atom at the 4-position adds to its reactivity and potential applications in organic synthesis. The trimethylsilyl group enhances the compound's stability and solubility in organic solvents, making it useful in various chemical reactions, including nucleophilic substitutions and as a protecting group for carboxylic acids. Its CAS number, 88239-39-8, allows for easy identification in chemical databases. Overall, this compound is significant in synthetic organic chemistry, particularly in the development of more complex molecules.
Formula:C7H13BrO2Si
InChI:InChI=1S/C7H13BrO2Si/c1-11(2,3)10-7(9)5-4-6-8/h4-5H,6H2,1-3H3/b5-4+
InChI key:GXBZWSOCDQRPJV-SNAWJCMRSA-N
SMILES:C[Si](C)(C)OC(=O)/C=C/CBr
Filter by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
- Lower prices
- Higher prices
- Lower purities
- Higher purities
- Faster estimated delivery
2-Butenoic acid, 4-bromo-, trimethylsilyl ester, (E)-
CAS:Formula:C7H13BrO2SiMolecular weight:237.1664
