CymitQuimica logo

CAS 88241-92-3

:

1,1':2',1'':3'',1''':2''',1''''-Quinquephenyl, 5''-phenyl-

Description:
1,1':2',1'':3'',1''':2''',1''''-Quinquephenyl, also known by its CAS number 88241-92-3, is a polyphenylene compound characterized by its unique structure comprising five phenyl rings interconnected in a specific arrangement. This compound exhibits notable properties such as high thermal stability and good solubility in organic solvents, making it suitable for various applications in materials science and organic electronics. Its extended π-conjugated system contributes to interesting optical properties, including potential use in light-emitting devices and organic photovoltaics. Additionally, quinquephenyl derivatives can exhibit interesting electronic properties, which may be leveraged in the development of advanced materials. The compound's synthesis typically involves coupling reactions, and its characterization can be performed using techniques such as NMR spectroscopy, mass spectrometry, and UV-Vis spectroscopy. Overall, 1,1':2',1'':3'',1''':2''',1''''-Quinquephenyl represents a fascinating subject of study in the field of organic chemistry and materials science due to its complex structure and potential applications.
Formula:C36H26
InChI:InChI=1S/C36H26/c1-4-14-27(15-5-1)30-24-31(35-22-12-10-20-33(35)28-16-6-2-7-17-28)26-32(25-30)36-23-13-11-21-34(36)29-18-8-3-9-19-29/h1-26H
InChI key:VTOXEUPZLUDUMP-UHFFFAOYSA-N
SMILES:C1=CC=C(C=C1)C2=CC=CC=C2C3=CC(=CC(=C3)C4=CC=CC=C4)C5=CC=CC=C5C6=CC=CC=C6
Found 1 products.