CAS 88245-71-0
:Acetamide, N-cyano-N-(1-methylethyl)-
Description:
Acetamide, N-cyano-N-(1-methylethyl)-, also known by its CAS number 88245-71-0, is an organic compound characterized by the presence of both an acetamide functional group and a cyano group. This compound typically appears as a colorless to pale yellow liquid or solid, depending on its specific form and purity. It is soluble in polar solvents, such as water and alcohols, due to the presence of the amide group, which can engage in hydrogen bonding. The cyano group contributes to its reactivity, making it a potential intermediate in organic synthesis. Acetamide derivatives are often studied for their biological activity, including potential applications in pharmaceuticals. The compound's stability under standard conditions allows for its use in various chemical reactions, although it may require careful handling due to the toxicity associated with cyanide derivatives. Overall, this compound exemplifies the diverse functionalities that can arise from simple organic structures, making it of interest in both industrial and research contexts.
Formula:C6H10N2O
InChI:InChI=1S/C6H10N2O/c1-5(2)8(4-7)6(3)9/h5H,1-3H3
InChI key:OTNORGGPYAGZDF-UHFFFAOYSA-N
SMILES:CC(C)N(C#N)C(=O)C
Filter by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
- Lower prices
- Higher prices
- Lower purities
- Higher purities
- Faster estimated delivery
