CymitQuimica logo

CAS 88250-26-4

:

Cyclopentane, pentachloro-

Description:
Cyclopentane, pentachloro- is a chlorinated hydrocarbon characterized by the presence of five chlorine atoms attached to a cyclopentane ring. This compound is typically a colorless liquid with a distinctive odor and is known for its high density and low volatility compared to non-chlorinated hydrocarbons. The presence of multiple chlorine atoms significantly alters its chemical properties, making it more reactive and less stable than its non-chlorinated counterparts. It is often used in various industrial applications, including as a solvent or in chemical synthesis. Due to its chlorinated nature, it may pose environmental and health risks, including potential toxicity and persistence in the environment. Proper handling and disposal are essential to mitigate these risks. Additionally, its use is regulated in many regions due to concerns about its impact on human health and the environment. Overall, cyclopentane, pentachloro- exemplifies the complexities associated with chlorinated organic compounds.
Formula:C5H5Cl5
InChI:InChI=1S/C5H5Cl5/c6-3-1-2-4(7,8)5(3,9)10/h3H,1-2H2
InChI key:OXJFVDXCMIIJJG-UHFFFAOYSA-N
SMILES:C1CC(C(C1Cl)(Cl)Cl)(Cl)Cl
Found 1 products.