CAS 88252-74-8

2H-1-Benzopyran, 6-methoxy-2,2,4-trimethyl-

Description:

2H-1-Benzopyran, 6-methoxy-2,2,4-trimethyl- is an organic compound characterized by its complex structure, which includes a benzopyran ring system and several methyl groups. This compound features a methoxy group at the 6-position, contributing to its chemical reactivity and potential applications. The presence of multiple methyl groups enhances its hydrophobicity and may influence its solubility in various organic solvents. Typically, compounds of this nature are studied for their potential biological activities, including antioxidant properties and effects on cellular processes. The molecular structure suggests that it may interact with various biological targets, making it of interest in medicinal chemistry and pharmacology. Additionally, the compound's stability and reactivity can be influenced by the arrangement of substituents on the benzopyran framework, which can affect its behavior in different chemical environments. Overall, 2H-1-Benzopyran, 6-methoxy-2,2,4-trimethyl- represents a class of compounds with diverse potential applications in research and industry.

Formula: C₁₃H₁₆O₂

InChI: InChI=1S/C13H16O2/c1-9-8-13(2,3)15-12-6-5-10(14-4)7-11(9)12/h5-8H,1-4H3

InChI key: JCQVFEPFFFKUCC-UHFFFAOYSA-N

SMILES: CC1=CC(OC2=C1C=C(C=C2)OC)(C)C

2H-1-Benzopyran, 6-methoxy-2,2,4-trimethyl-

CAS: 88252-74-8

Formula: C₁₃H₁₆O₂

Molecular weight: 204.2649

Ref: IN-DA004CH0