CAS 88253-93-4
:Benzenamine, 3-[(2,4,5-trichlorophenoxy)methyl]-
Description:
Benzenamine, 3-[(2,4,5-trichlorophenoxy)methyl]- is an organic compound characterized by its amine functional group and a substituted phenyl ring. It features a trichlorophenoxy group, which indicates the presence of three chlorine atoms on a phenolic structure, contributing to its chemical stability and potential biological activity. This compound is typically used in various applications, including as an intermediate in the synthesis of agrochemicals and pharmaceuticals. Its molecular structure suggests it may exhibit hydrophobic properties due to the presence of the chlorinated aromatic moiety, which can influence its solubility and reactivity. Additionally, the amine group can participate in hydrogen bonding, affecting its interactions with other molecules. Safety and handling precautions are essential due to the potential toxicity associated with chlorinated compounds. Overall, Benzenamine, 3-[(2,4,5-trichlorophenoxy)methyl]- is a compound of interest in both industrial and research settings, warranting further investigation into its properties and applications.
Formula:C13H10Cl3NO
InChI:InChI=1S/C13H10Cl3NO/c14-10-5-12(16)13(6-11(10)15)18-7-8-2-1-3-9(17)4-8/h1-6H,7,17H2
InChI key:IUJPGCHKIONUJB-UHFFFAOYSA-N
SMILES:C1=CC(=CC(=C1)N)COC2=CC(=C(C=C2Cl)Cl)Cl
Filter by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
- Lower prices
- Higher prices
- Lower purities
- Higher purities
- Faster estimated delivery
