CAS 88255-51-0
:Pentanoic acid, 2,2,3,3-tetramethyl-, methyl ester
Description:
Pentanoic acid, 2,2,3,3-tetramethyl-, methyl ester, also known as methyl 2,2,3,3-tetramethylpentanoate, is an ester derived from pentanoic acid and methanol. This compound features a branched alkyl chain, which contributes to its unique physical and chemical properties. It is typically a colorless to pale yellow liquid with a characteristic fruity odor. The presence of multiple methyl groups in its structure enhances its hydrophobic characteristics, making it less soluble in water but more soluble in organic solvents. This compound is often used in the synthesis of various chemicals and as a flavoring agent due to its pleasant aroma. Its boiling point and melting point are influenced by the branching of the carbon chain, which can affect its volatility and stability. Additionally, like many esters, it may undergo hydrolysis in the presence of water and acids or bases, reverting to its parent acid and alcohol. Safety data should be consulted for handling and exposure guidelines, as with all chemical substances.
Formula:C10H20O2
InChI:InChI=1S/C10H20O2/c1-7-9(2,3)10(4,5)8(11)12-6/h7H2,1-6H3
InChI key:OTCXXDINWCIYNR-UHFFFAOYSA-N
SMILES:CCC(C)(C)C(C)(C)C(=O)OC
Filter by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
- Lower prices
- Higher prices
- Lower purities
- Higher purities
- Faster estimated delivery
