CymitQuimica logo

CAS 88257-39-0

:

3-Pentanone, 1-phenyl-4-(trimethylsilyl)-

Description:
3-Pentanone, 1-phenyl-4-(trimethylsilyl)-, also known by its CAS number 88257-39-0, is an organic compound characterized by its ketone functional group and the presence of a phenyl group along with a trimethylsilyl substituent. This compound typically exhibits a moderate boiling point and is likely to be a colorless liquid at room temperature. Its structure suggests it may have moderate polarity due to the presence of the carbonyl group, which can engage in dipole-dipole interactions. The trimethylsilyl group enhances its stability and solubility in organic solvents, making it useful in various synthetic applications, particularly in organic synthesis and as a reagent in chemical reactions. Additionally, the presence of the phenyl group may impart unique reactivity and properties, such as increased aromatic character. Overall, this compound is of interest in both academic and industrial chemistry for its potential applications in synthesis and as an intermediate in the production of more complex molecules.
Formula:C14H22OSi
InChI:InChI=1S/C14H22OSi/c1-12(16(2,3)4)14(15)11-10-13-8-6-5-7-9-13/h5-9,12H,10-11H2,1-4H3
InChI key:ZRINQVORVXEFDN-UHFFFAOYSA-N
SMILES:CC(C(=O)CCC1=CC=CC=C1)[Si](C)(C)C
Found 1 products.