CymitQuimica logo

CAS 88258-01-9

:

Silane, bis[2,3-dimethyl-4-(trimethylsilyl)-2-butenyl]dimethyl-

Description:
Silane, bis[2,3-dimethyl-4-(trimethylsilyl)-2-butenyl]dimethyl- is an organosilicon compound characterized by its silane functional group, which contains silicon atoms bonded to organic groups. This compound features a complex structure with multiple alkyl substituents, specifically two 2,3-dimethyl-4-(trimethylsilyl)-2-butenyl groups and two dimethyl groups attached to the silicon atom. The presence of the trimethylsilyl groups enhances its stability and reactivity, making it useful in various applications, including as a coupling agent or in silicone polymer synthesis. The compound is likely to be a colorless or pale yellow liquid, exhibiting low volatility and moderate solubility in organic solvents. Its reactivity can be attributed to the presence of unsaturated carbon-carbon bonds, which may participate in further chemical reactions. Safety data should be consulted for handling, as organosilicon compounds can have specific hazards associated with them. Overall, this silane derivative is of interest in materials science and organic synthesis due to its unique structural features.
Formula:C20H44Si3
InChI:InChI=1S/C20H44Si3/c1-17(13-21(5,6)7)19(3)15-23(11,12)16-20(4)18(2)14-22(8,9)10/h13-16H2,1-12H3
InChI key:LNKGURFAVJNJHS-UHFFFAOYSA-N
SMILES:CC(=C(C)C[Si](C)(C)CC(=C(C)C[Si](C)(C)C)C)C[Si](C)(C)C
Found 1 products.