CAS 88258-04-2
:Phosphonic acid, (1,3-dimethyl-1,3-butadienyl)-
Description:
Phosphonic acid, (1,3-dimethyl-1,3-butadienyl)-, also known by its CAS number 88258-04-2, is an organophosphorus compound characterized by the presence of a phosphonic acid functional group attached to a butadiene backbone with two methyl substituents. This compound typically exhibits properties associated with phosphonic acids, such as being a strong acid due to the presence of the phosphonic acid group, which can donate protons in aqueous solutions. It is likely to be soluble in polar solvents, and its structure may confer unique reactivity, particularly in relation to biological systems or as a potential herbicide or pesticide. The presence of the butadienyl group suggests potential for polymerization or other reactions typical of conjugated systems. Additionally, compounds of this nature may exhibit biological activity, making them of interest in agricultural and pharmaceutical applications. However, specific safety and handling guidelines should be followed due to the potential toxicity associated with organophosphorus compounds.
Formula:C6H11O3P
InChI:InChI=1S/C6H11O3P/c1-5(2)4-6(3)10(7,8)9/h4H,1H2,2-3H3,(H2,7,8,9)
InChI key:SSUYASWJXAEBCY-UHFFFAOYSA-N
SMILES:CC(=C)C=C(C)P(=O)(O)O
Filter by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
- Lower prices
- Higher prices
- Lower purities
- Higher purities
- Faster estimated delivery
