CAS 88258-71-3
:Urea, N-(5,6-dihydro-2-methyl-1,4-oxathiin-3-yl)-N'-phenyl-
Description:
Urea, N-(5,6-dihydro-2-methyl-1,4-oxathiin-3-yl)-N'-phenyl- is a chemical compound characterized by its unique structure, which includes a urea functional group and a substituted oxathiin ring. The presence of the oxathiin moiety contributes to its potential biological activity and chemical reactivity. This compound may exhibit properties typical of both urea derivatives and heterocyclic compounds, such as solubility in polar solvents and potential interactions with biological targets. Its molecular structure suggests it could participate in hydrogen bonding due to the urea group, influencing its physical properties like melting point and boiling point. Additionally, the phenyl group may enhance lipophilicity, affecting its distribution in biological systems. The compound's specific applications and safety profile would depend on further studies, including toxicity assessments and pharmacological evaluations. As with many chemical substances, proper handling and storage conditions are essential to ensure safety and stability.
Formula:C12H14N2O2S
InChI:InChI=1S/C12H14N2O2S/c1-9-11(17-8-7-16-9)14-12(15)13-10-5-3-2-4-6-10/h2-6H,7-8H2,1H3,(H2,13,14,15)
InChI key:QAEQPZZJYYFDPL-UHFFFAOYSA-N
SMILES:CC1=C(SCCO1)NC(=O)NC2=CC=CC=C2
Filter by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
- Lower prices
- Higher prices
- Lower purities
- Higher purities
- Faster estimated delivery
Urea, N-(5,6-dihydro-2-methyl-1,4-oxathiin-3-yl)-N'-phenyl-
CAS:Formula:C12H14N2O2SMolecular weight:250.3168
