CAS 88258-82-6
:3-Piperidinecarbonitrile, 3-(phenylamino)-1-(phenylmethyl)-
Description:
3-Piperidinecarbonitrile, 3-(phenylamino)-1-(phenylmethyl)-, identified by CAS number 88258-82-6, is a chemical compound characterized by its piperidine ring structure, which is a six-membered nitrogen-containing heterocycle. This compound features a phenylamino group and a phenylmethyl substituent, contributing to its potential biological activity and applications in medicinal chemistry. The presence of the carbonitrile functional group indicates that it may exhibit reactivity typical of nitriles, such as nucleophilic addition. The molecular structure suggests that it may possess properties such as lipophilicity, which can influence its solubility and permeability in biological systems. Additionally, the compound may interact with various biological targets, making it of interest in drug discovery and development. Its synthesis and characterization would typically involve standard organic chemistry techniques, and its stability and reactivity would be influenced by the electronic effects of the substituents on the piperidine ring. Overall, this compound represents a class of molecules that could be explored for therapeutic applications.
Formula:C19H21N3
InChI:InChI=1S/C19H21N3/c20-15-19(21-18-10-5-2-6-11-18)12-7-13-22(16-19)14-17-8-3-1-4-9-17/h1-6,8-11,21H,7,12-14,16H2
InChI key:UUMGHRSFNJINED-UHFFFAOYSA-N
SMILES:C1CC(CN(C1)CC2=CC=CC=C2)(C#N)NC3=CC=CC=C3
Filter by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
- Lower prices
- Higher prices
- Lower purities
- Higher purities
- Faster estimated delivery
3-Piperidinecarbonitrile, 3-(phenylamino)-1-(phenylmethyl)-
CAS:Formula:C19H21N3Molecular weight:291.3901
