CAS 88259-93-2
:3(2H)-Pyridazinone, 6-(dipropylamino)-
Description:
3(2H)-Pyridazinone, 6-(dipropylamino)- is a chemical compound characterized by its pyridazinone core structure, which features a six-membered ring containing two nitrogen atoms and a carbonyl group. The presence of a dipropylamino group at the 6-position enhances its solubility and potential biological activity. This compound is typically a solid at room temperature and may exhibit moderate to high stability under standard conditions. Its molecular structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to the presence of the pyridazinone moiety, which is known for various biological activities. The compound may also display specific interactions with biological targets, making it of interest for further research. Safety and handling precautions should be observed, as with any chemical substance, to mitigate risks associated with exposure. Overall, 3(2H)-Pyridazinone, 6-(dipropylamino)- represents a unique structure that could be explored for its chemical and biological properties.
Formula:C10H17N3O
InChI:InChI=1S/C10H17N3O/c1-3-7-13(8-4-2)9-5-6-10(14)12-11-9/h5-6H,3-4,7-8H2,1-2H3,(H,12,14)
InChI key:KRRQYPWJCMSHMC-UHFFFAOYSA-N
SMILES:CCCN(CCC)C1=NNC(=O)C=C1
Filter by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
- Lower prices
- Higher prices
- Lower purities
- Higher purities
- Faster estimated delivery
