CAS 88260-30-4

Pyridine, 4-(3-chloro-3-cyclohexen-1-yl)-

Description:

Pyridine, 4-(3-chloro-3-cyclohexen-1-yl)-, with the CAS number 88260-30-4, is an organic compound characterized by its pyridine ring, which is a six-membered aromatic heterocycle containing one nitrogen atom. This compound features a substituent at the 4-position of the pyridine ring, specifically a 3-chloro-3-cyclohexen-1-yl group, which introduces a cyclohexene moiety with a chlorine atom. The presence of the chlorine atom and the cyclohexene structure contributes to its reactivity and potential applications in organic synthesis. Pyridine derivatives are known for their diverse biological activities, including antimicrobial and anti-inflammatory properties. The compound is typically a colorless to pale yellow liquid or solid, depending on its purity and specific conditions. It is soluble in organic solvents and may exhibit moderate toxicity, necessitating careful handling. As with many pyridine derivatives, it may participate in various chemical reactions, including nucleophilic substitutions and electrophilic aromatic substitutions, making it valuable in synthetic organic chemistry.

Formula: C₁₁H₁₂ClN

InChI: InChI=1S/C11H12ClN/c12-11-3-1-2-10(8-11)9-4-6-13-7-5-9/h3-7,10H,1-2,8H2

InChI key: YOLKMUKEPUDTCL-UHFFFAOYSA-N

SMILES: C1CC(CC(=C1)Cl)C2=CC=NC=C2

Pyridine, 4-(3-chloro-3-cyclohexen-1-yl)-

CAS: 88260-30-4

Formula: C₁₁H₁₂ClN

Molecular weight: 193.6727

Ref: IN-DA004C0F