CAS 88261-87-4
:Phosphoric acid, bis(1-methylethyl)2,3,4,5-tetrachloro-6-[[(methylamino)carbonyl]oxy]phenyl ester
Description:
Phosphoric acid, bis(1-methylethyl) 2,3,4,5-tetrachloro-6-[[(methylamino)carbonyl]oxy]phenyl ester, identified by CAS number 88261-87-4, is a complex organic compound characterized by its phosphoric acid backbone and multiple functional groups. This substance features a phosphoric acid ester structure, which contributes to its reactivity and potential applications in various chemical processes. The presence of tetrachloro substituents indicates a high degree of chlorination, which can enhance its stability and alter its solubility in different solvents. The methylamino and carbonyl groups suggest potential for biological activity, making it of interest in fields such as pharmaceuticals or agrochemicals. Its esterification with isopropyl groups may influence its physical properties, such as volatility and viscosity. Overall, this compound's unique structure and functional groups suggest it may have specialized applications, though specific safety and handling guidelines should be consulted due to the presence of chlorine and other reactive moieties.
Formula:C14H18Cl4NO6P
InChI:InChI=1S/C14H20Cl4NO6P/c1-6(2)13(18)10(17)8(15)9(16)11(24-12(20)19-5)14(13,7(3)4)25-26(21,22)23/h6-7H,1-5H3,(H,19,20)(H2,21,22,23)/p-2
InChI key:MUCJFZXDZJHNAQ-UHFFFAOYSA-L
SMILES:CC(C)C1(C(=C(C(=C(C1(C(C)C)Cl)Cl)Cl)Cl)OC(=O)NC)OP(=O)([O-])[O-]
Filter by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
- Lower prices
- Higher prices
- Lower purities
- Higher purities
- Faster estimated delivery
Phosphoric acid, bis(1-methylethyl)2,3,4,5-tetrachloro-6-[[(methylamino)carbonyl]oxy]phenyl ester
CAS:Formula:C14H18Cl4NO6PMolecular weight:469.0816
