CymitQuimica logo

CAS 88261-88-5

:

Phosphoric acid, dimethyl2,3,5,6-tetrachloro-4-[[(methylamino)carbonyl]oxy]phenyl ester

Description:
Phosphoric acid, dimethyl 2,3,5,6-tetrachloro-4-[[(methylamino)carbonyl]oxy]phenyl ester, identified by CAS number 88261-88-5, is a chemical compound that belongs to the class of organophosphates. This substance features a phosphoric acid backbone, which is esterified with a complex aromatic structure that includes multiple chlorine substituents and a methylamino group. The presence of the tetrachloro substituents indicates a high degree of chlorination, which can influence the compound's reactivity and biological activity. Organophosphates are often characterized by their potential use in agricultural applications, particularly as pesticides or herbicides, due to their ability to interfere with the normal functioning of biological systems. The methylamino group suggests potential interactions with biological targets, possibly affecting enzyme activity or cellular processes. Safety and handling precautions are essential when working with such compounds, as they may exhibit toxicity or environmental persistence. Overall, this compound exemplifies the complexity and utility of organophosphate chemistry in various applications.
Formula:C10H10Cl4NO6P
InChI:InChI=1S/C10H12Cl4NO6P/c1-9(14)7(13)5(20-8(16)15-3)4(11)6(12)10(9,2)21-22(17,18)19/h1-3H3,(H,15,16)(H2,17,18,19)/p-2
InChI key:BAXXZLAULMOWRE-UHFFFAOYSA-L
SMILES:CC1(C(=C(C(=C(C1(C)Cl)Cl)OC(=O)NC)Cl)Cl)OP(=O)([O-])[O-]
Found 1 products.