CAS 88262-35-5
:Anthracene, 1,2-dihydro-9,10-dimethyl-
Description:
Anthracene, 1,2-dihydro-9,10-dimethyl- (CAS 88262-35-5) is a polycyclic aromatic hydrocarbon characterized by its structure, which includes a fused ring system derived from anthracene with additional methyl groups and a dihydro modification. This compound typically appears as a solid at room temperature and is known for its aromatic properties, contributing to its stability and potential applications in organic electronics and materials science. It is relatively insoluble in water but can dissolve in organic solvents such as benzene and toluene. The presence of methyl groups influences its reactivity and physical properties, including melting and boiling points. As with many polycyclic aromatic hydrocarbons, it may exhibit fluorescence, making it of interest in photonic applications. Safety considerations are important, as some derivatives of anthracene can be toxic or carcinogenic, necessitating careful handling and appropriate safety measures in laboratory settings. Overall, this compound represents a unique intersection of organic chemistry and material science, with potential utility in various industrial applications.
Formula:C16H16
InChI:InChI=1S/C16H16/c1-11-13-7-3-5-9-15(13)12(2)16-10-6-4-8-14(11)16/h3-5,7-9H,6,10H2,1-2H3
InChI key:AZDAIASRFCVNQS-UHFFFAOYSA-N
SMILES:CC1=C2CCC=CC2=C(C3=CC=CC=C13)C
Filter by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
- Lower prices
- Higher prices
- Lower purities
- Higher purities
- Faster estimated delivery
