CAS 88262-59-3
:Glycinamide, L-tyrosyl-D-alanyl-L-phenylalanyl-N-(3-oxobutyl)-
Description:
Glycinamide, L-tyrosyl-D-alanyl-L-phenylalanyl-N-(3-oxobutyl)-, identified by the CAS number 88262-59-3, is a synthetic peptide that incorporates various amino acid residues, contributing to its unique properties. This compound features a glycinamide backbone, which is a derivative of glycine, and includes L-tyrosine, D-alanine, and L-phenylalanine, each of which plays a role in the peptide's structure and function. The presence of the N-(3-oxobutyl) group suggests that it may exhibit specific biological activities or interactions, potentially influencing its solubility, stability, and reactivity. Peptides like this one are often studied for their potential applications in pharmaceuticals, biochemistry, and molecular biology, particularly in the context of drug design and therapeutic development. The stereochemistry of the amino acids can also affect the compound's biological activity, making it a subject of interest in research focused on peptide synthesis and modification. Overall, this compound exemplifies the complexity and versatility of peptide chemistry.
Formula:C27H35N5O6
InChI:InChI=1S/C27H35N5O6/c1-17(33)12-13-29-24(35)16-30-27(38)23(15-19-6-4-3-5-7-19)32-25(36)18(2)31-26(37)22(28)14-20-8-10-21(34)11-9-20/h3-11,18,22-23,34H,12-16,28H2,1-2H3,(H,29,35)(H,30,38)(H,31,37)(H,32,36)/t18-,22+,23+/m1/s1
InChI key:RJVRDTYYCTVOFS-LEOXJPRUSA-N
SMILES:C[C@H](C(=O)N[C@@H](CC1=CC=CC=C1)C(=O)NCC(=O)NCCC(=O)C)NC(=O)[C@H](CC2=CC=C(C=C2)O)N
Filter by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
- Lower prices
- Higher prices
- Lower purities
- Higher purities
- Faster estimated delivery
Glycinamide, L-tyrosyl-D-alanyl-L-phenylalanyl-N-(3-oxobutyl)-
CAS:Formula:C27H35N5O6Molecular weight:525.5967
