CymitQuimica logo

CAS 88264-21-5

:

Oxazole, 2-[(4-fluorophenyl)sulfinyl]-4,5-bis(4-methoxyphenyl)-

Description:
Oxazole, 2-[(4-fluorophenyl)sulfinyl]-4,5-bis(4-methoxyphenyl)-, identified by CAS number 88264-21-5, is a heterocyclic organic compound featuring an oxazole ring, which is a five-membered aromatic ring containing both nitrogen and oxygen atoms. This compound is characterized by the presence of a sulfinyl group attached to a 4-fluorophenyl moiety, as well as two 4-methoxyphenyl substituents. The sulfinyl group contributes to its potential reactivity and solubility properties, while the methoxy groups enhance its electron-donating characteristics, which can influence its biological activity and interaction with other molecules. The fluorine atom in the 4-fluorophenyl group may also affect the compound's electronic properties and lipophilicity. Overall, this compound's unique structural features suggest potential applications in medicinal chemistry, particularly in the development of pharmaceuticals or agrochemicals, although specific biological activities would require further investigation.
Formula:C23H18FNO4S
InChI:InChI=1S/C23H18FNO4S/c1-27-18-9-3-15(4-10-18)21-22(16-5-11-19(28-2)12-6-16)29-23(25-21)30(26)20-13-7-17(24)8-14-20/h3-14H,1-2H3
InChI key:QAKFLOVZSZIGTL-UHFFFAOYSA-N
SMILES:COC1=CC=C(C=C1)C2=C(OC(=N2)S(=O)C3=CC=C(C=C3)F)C4=CC=C(C=C4)OC
Found 1 products.