CymitQuimica logo

CAS 882679-40-5

:

Benzoicacid, 4-methyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-, methyl ester

Description:
The chemical substance known as "Benzoic acid, 4-methyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-, methyl ester," with CAS number 882679-40-5, is an organic compound characterized by its complex structure that includes a benzoic acid moiety and a boron-containing group. This compound features a methyl ester functional group, which enhances its solubility in organic solvents and may influence its reactivity. The presence of the tetramethyl-1,3,2-dioxaborolane group suggests potential applications in organic synthesis, particularly in cross-coupling reactions or as a boron source in various chemical transformations. The compound is likely to exhibit moderate to low toxicity, typical of many organic esters, but specific safety data should be consulted for handling and usage. Its unique structure may also impart specific properties such as stability under certain conditions and potential utility in medicinal chemistry or materials science. Overall, this compound represents a specialized class of organic molecules with potential applications in various fields of chemistry.
Formula:C15H21BO4
InChI:InChI=1S/C15H21BO4/c1-10-7-8-11(13(17)18-6)9-12(10)16-19-14(2,3)15(4,5)20-16/h7-9H,1-6H3
InChI key:HAPIXNBOBZHNCA-UHFFFAOYSA-N
SMILES:B1(OC(C(O1)(C)C)(C)C)C2=C(C=CC(=C2)C(=O)OC)C
Synonyms:
  • 4-Methyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoicacid methyl ester
  • Methyl 4-Methyl-3-(4,4,5,5-Tetramethyl-1,3,2-Dioxaborolan-2-Yl)Benzoate
Found 4 products.