CymitQuimica logo

CAS 88268-68-2

:

Benzoic acid, 4-(2-propoxyethoxy)-, 4-methylphenyl ester

Description:
Benzoic acid, 4-(2-propoxyethoxy)-, 4-methylphenyl ester, identified by CAS number 88268-68-2, is an organic compound characterized by its ester functional group. This compound features a benzoic acid moiety linked to a 4-methylphenyl group, along with a propoxyethoxy substituent, which contributes to its solubility and reactivity. It typically appears as a colorless to pale yellow liquid or solid, depending on its purity and specific conditions. The presence of the ester group suggests that it may exhibit moderate volatility and can participate in hydrolysis reactions under certain conditions. Its structure indicates potential applications in various fields, including pharmaceuticals, agrochemicals, and as a potential intermediate in organic synthesis. The compound's properties, such as melting point, boiling point, and solubility, would be influenced by the steric and electronic effects of its substituents. Safety data should be consulted for handling and storage, as with any chemical substance, to ensure proper precautions are taken.
Formula:C19H22O4
InChI:InChI=1S/C19H22O4/c1-3-12-21-13-14-22-17-10-6-16(7-11-17)19(20)23-18-8-4-15(2)5-9-18/h4-11H,3,12-14H2,1-2H3
InChI key:NTEPAKTUGAJRAO-UHFFFAOYSA-N
SMILES:CCCOCCOC1=CC=C(C=C1)C(=O)OC2=CC=C(C=C2)C
Found 1 products.