CymitQuimica logo

CAS 882682-79-3

:

1H-Pyrrolo[3,2-b]pyridine, 2,3-dimethyl-7-[(3-methylphenyl)methoxy]-

Description:
1H-Pyrrolo[3,2-b]pyridine, 2,3-dimethyl-7-[(3-methylphenyl)methoxy]- is a chemical compound characterized by its complex bicyclic structure, which includes a pyrrole and pyridine ring system. This compound features multiple substituents, including dimethyl groups and a methoxy group attached to a phenyl ring, contributing to its unique chemical properties. It is typically classified as an organic heterocyclic compound due to the presence of nitrogen atoms in its ring structure. The presence of various functional groups suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals. The compound may exhibit interesting biological activities, which can be explored through further research. Its solubility, stability, and reactivity can vary based on the specific conditions and solvents used. As with many organic compounds, safety data should be consulted to understand its handling and potential hazards. Overall, this compound represents a fascinating area of study within organic and medicinal chemistry.
Formula:C17H18N2O
InChI:InChI=1S/C17H18N2O/c1-11-5-4-6-14(9-11)10-20-15-7-8-18-16-12(2)13(3)19-17(15)16/h4-9,19H,10H2,1-3H3
InChI key:DRFRZTRNDYOJJV-UHFFFAOYSA-N
SMILES:CC1=CC(=CC=C1)COC2=C3C(=NC=C2)C(=C(N3)C)C
Found 1 products.