CymitQuimica logo

CAS 88280-61-9

:

Morpholine, 4-[1-(4-bromophenyl)-2-(3-pyridinyl)ethenyl]-

Description:
Morpholine, 4-[1-(4-bromophenyl)-2-(3-pyridinyl)ethenyl]- is a chemical compound characterized by its unique structure, which includes a morpholine ring and a vinyl group substituted with a bromophenyl and pyridinyl moiety. This compound typically exhibits properties associated with both morpholine derivatives and aromatic compounds, such as moderate solubility in organic solvents and potential reactivity due to the presence of the double bond in the vinyl group. The bromine atom in the para position of the phenyl ring can influence the compound's electronic properties, potentially enhancing its reactivity in electrophilic substitution reactions. Additionally, the pyridine ring contributes to the compound's basicity and can participate in coordination with metal ions. Morpholine derivatives are often studied for their biological activity, and this specific compound may exhibit interesting pharmacological properties due to its structural features. As with many organic compounds, safety and handling precautions should be observed, particularly due to the presence of bromine, which can be hazardous.
Formula:C17H17BrN2O
InChI:InChI=1S/C17H17BrN2O/c18-16-5-3-15(4-6-16)17(20-8-10-21-11-9-20)12-14-2-1-7-19-13-14/h1-7,12-13H,8-11H2
InChI key:UNELCWHNGSBRFJ-UHFFFAOYSA-N
SMILES:C1COCCN1C(=CC2=CN=CC=C2)C3=CC=C(C=C3)Br
Found 1 products.