CymitQuimica logo

CAS 88280-73-3

:

Benzamide, N,N'-1,6-hexanediylbis[2-ethenyl-

Description:
Benzamide, N,N'-1,6-hexanediylbis[2-ethenyl-] is an organic compound characterized by its amide functional group and a structure that includes a hexanediyl chain linking two benzamide units. The presence of the ethenyl groups suggests that this compound has unsaturation, which can influence its reactivity and physical properties. Typically, compounds of this nature may exhibit moderate solubility in organic solvents and limited solubility in water due to the hydrophobic nature of the benzene rings and the alkyl chain. The compound may also participate in various chemical reactions, such as polymerization, due to the presence of the ethenyl groups. Its molecular structure indicates potential applications in materials science, particularly in the synthesis of polymers or as intermediates in organic synthesis. Safety data should be consulted for handling and storage, as compounds with similar structures can vary in toxicity and reactivity. Overall, this compound exemplifies the diverse chemistry of amides and their derivatives in organic synthesis and materials development.
Formula:C24H28N2O2
InChI:InChI=1S/C24H28N2O2/c1-3-19-13-7-9-15-21(19)23(27)25-17-11-5-6-12-18-26-24(28)22-16-10-8-14-20(22)4-2/h3-4,7-10,13-16H,1-2,5-6,11-12,17-18H2,(H,25,27)(H,26,28)
InChI key:ILPVVJYCMDHUBU-UHFFFAOYSA-N
SMILES:C=CC1=CC=CC=C1C(=O)NCCCCCCNC(=O)C2=CC=CC=C2C=C
Found 1 products.