CymitQuimica logo

CAS 88280-89-1

:

3(2H)-Benzofuranone, 2-cyclohexylidene-6-hydroxy-

Description:
3(2H)-Benzofuranone, 2-cyclohexylidene-6-hydroxy- is an organic compound characterized by its unique structure, which includes a benzofuranone core with a cyclohexylidene substituent and a hydroxyl group. This compound typically exhibits properties associated with both aromatic and cyclic structures, contributing to its potential reactivity and stability. The presence of the hydroxyl group suggests it may engage in hydrogen bonding, influencing its solubility and interaction with other molecules. Additionally, the cyclohexylidene moiety can impart steric effects that may affect the compound's reactivity and physical properties. Such compounds are often studied for their potential applications in pharmaceuticals, agrochemicals, and materials science due to their interesting chemical behavior and biological activity. The specific characteristics, such as melting point, boiling point, and solubility, would depend on the compound's molecular interactions and the environment in which it is studied. Overall, 3(2H)-Benzofuranone, 2-cyclohexylidene-6-hydroxy- represents a class of compounds with diverse applications and significant chemical interest.
Formula:C14H14O3
InChI:InChI=1S/C14H14O3/c15-10-6-7-11-12(8-10)17-14(13(11)16)9-4-2-1-3-5-9/h6-8,15H,1-5H2
InChI key:AORXDXVOXDLFST-UHFFFAOYSA-N
SMILES:C1CCC(=C2C(=O)C3=C(O2)C=C(C=C3)O)CC1
Found 1 products.