CAS 88281-27-0
:3(2H)-Benzofuranone, 6-(3-bromopropoxy)-2-(1-methylethylidene)-
Description:
3(2H)-Benzofuranone, 6-(3-bromopropoxy)-2-(1-methylethylidene)-, with the CAS number 88281-27-0, is an organic compound characterized by its complex structure that includes a benzofuranone core, a bromopropoxy substituent, and an isopropenyl group. This compound typically exhibits properties associated with both aromatic and aliphatic systems, contributing to its potential reactivity and stability. The presence of the bromine atom suggests that it may participate in nucleophilic substitution reactions, while the isopropenyl group can engage in various addition reactions. The benzofuranone moiety may impart certain biological activities, making it of interest in medicinal chemistry. Additionally, the compound's solubility and behavior in different solvents can vary, influenced by its functional groups. Overall, this substance may have applications in pharmaceuticals, agrochemicals, or as an intermediate in organic synthesis, although specific applications would depend on further research into its properties and reactivity.
Formula:C14H15BrO3
InChI:InChI=1S/C14H15BrO3/c1-9(2)14-13(16)11-5-4-10(8-12(11)18-14)17-7-3-6-15/h4-5,8H,3,6-7H2,1-2H3
InChI key:IOVJULLMBUKXNP-UHFFFAOYSA-N
SMILES:CC(=C1C(=O)C2=C(O1)C=C(C=C2)OCCCBr)C
Filter by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
- Lower prices
- Higher prices
- Lower purities
- Higher purities
- Faster estimated delivery
3(2H)-Benzofuranone, 6-(3-bromopropoxy)-2-(1-methylethylidene)-
CAS:Formula:C14H15BrO3Molecular weight:311.1711
