CymitQuimica logo

CAS 88281-83-8

:

Acetic acid, [(4-phenyl-2-thiazolyl)hydrazono]-, methyl ester

Description:
Acetic acid, [(4-phenyl-2-thiazolyl)hydrazono]-, methyl ester, with the CAS number 88281-83-8, is an organic compound characterized by its functional groups and structural features. It is a derivative of acetic acid, incorporating a hydrazone linkage and a thiazole ring, which contributes to its unique chemical properties. The presence of the phenyl group enhances its aromatic characteristics, potentially influencing its reactivity and solubility. This compound may exhibit biological activity due to the thiazole moiety, which is often associated with various pharmacological properties. In terms of physical properties, it is likely to be a liquid or solid at room temperature, with moderate polarity due to the ester and hydrazone functionalities. Its synthesis typically involves the reaction of acetic acid derivatives with hydrazones and thiazole-containing compounds. As with many organic compounds, it is important to handle it with care, considering potential toxicity and environmental impact. Overall, this compound represents a complex structure with potential applications in medicinal chemistry and organic synthesis.
Formula:C12H11N3O2S
InChI:InChI=1S/C12H11N3O2S/c1-17-11(16)7-13-15-12-14-10(8-18-12)9-5-3-2-4-6-9/h2-8H,1H3,(H,14,15)
InChI key:JGRZPGWAPXUJPJ-UHFFFAOYSA-N
SMILES:COC(=O)C=NNC1=NC(=CS1)C2=CC=CC=C2
Found 1 products.