CymitQuimica logo

CAS 88283-33-4

:

Ethanone, 1-(3-chlorophenyl)-2-pyrazinyl-

Description:
Ethanone, 1-(3-chlorophenyl)-2-pyrazinyl- is an organic compound characterized by its pyrazine and ketone functional groups. It features a pyrazinyl moiety, which is a bicyclic structure containing two nitrogen atoms in a six-membered ring, contributing to its potential biological activity. The presence of the 3-chlorophenyl group indicates that it has a chlorine substituent on the aromatic ring, which can influence its reactivity and interaction with biological targets. This compound is typically used in research and development, particularly in the fields of medicinal chemistry and pharmacology, due to its potential as a lead compound in drug discovery. Its molecular structure suggests it may exhibit various properties, including lipophilicity and the ability to form hydrogen bonds, which are critical for its biological activity. Safety and handling precautions should be observed, as with many organic compounds, due to potential toxicity or environmental impact. Further studies would be necessary to fully elucidate its properties and applications.
Formula:C12H9ClN2O
InChI:InChI=1S/C12H9ClN2O/c13-10-3-1-2-9(6-10)12(16)7-11-8-14-4-5-15-11/h1-6,8H,7H2
InChI key:SFLHLKQAGJFAIL-UHFFFAOYSA-N
SMILES:C1=CC(=CC(=C1)Cl)C(=O)CC2=NC=CN=C2
Found 1 products.