CymitQuimica logo

CAS 88288-12-4

:

N-(5-bromo-2-fluorophenyl)acetamide

Description:
N-(5-bromo-2-fluorophenyl)acetamide is an organic compound characterized by its acetamide functional group attached to a phenyl ring that is substituted with both bromine and fluorine atoms. The presence of the bromine atom at the 5-position and the fluorine atom at the 2-position of the phenyl ring contributes to its unique chemical properties, including potential reactivity and biological activity. This compound is typically a solid at room temperature and may exhibit moderate solubility in organic solvents. Its molecular structure suggests that it could participate in various chemical reactions, such as nucleophilic substitutions or coupling reactions, making it of interest in medicinal chemistry and material science. Additionally, the halogen substituents may influence its electronic properties and interactions with biological targets, potentially leading to applications in pharmaceuticals. As with many halogenated compounds, safety precautions should be taken when handling due to potential toxicity and environmental concerns.
Formula:C8H7BrFNO
InChI:InChI=1/C8H7BrFNO/c1-5(12)11-8-4-6(9)2-3-7(8)10/h2-4H,1H3,(H,11,12)
InChI key:DCMNLQCVRYDPMY-UHFFFAOYSA-N
SMILES:CC(=Nc1cc(ccc1F)Br)O
Found 3 products.