CAS 88295-95-8
:2-Propenamide, 2-methyl-N-(1-methylethyl)-N-(phenylthioxomethyl)-
Description:
2-Propenamide, 2-methyl-N-(1-methylethyl)-N-(phenylthioxomethyl)-, identified by CAS number 88295-95-8, is an organic compound characterized by its amide functional group and a propenamide backbone. This compound features a branched alkyl group (isopropyl) and a phenyl group, contributing to its structural complexity and potential reactivity. The presence of the thioxomethyl group introduces sulfur into the molecular structure, which can influence its chemical behavior and interactions. Typically, compounds of this nature may exhibit properties such as moderate solubility in organic solvents and potential reactivity in various chemical reactions, including nucleophilic substitutions or polymerization processes. The specific characteristics, such as melting point, boiling point, and reactivity, would depend on the molecular interactions and the environment in which the compound is used. Due to its unique structure, this compound may find applications in fields such as organic synthesis, materials science, or pharmaceuticals, although specific applications would require further investigation into its properties and behavior in various conditions.
Formula:C14H17NOS
InChI:InChI=1S/C14H17NOS/c1-10(2)13(16)15(11(3)4)14(17)12-8-6-5-7-9-12/h5-9,11H,1H2,2-4H3
InChI key:LUCXXANUIBKOIP-UHFFFAOYSA-N
SMILES:CC(C)N(C(=S)C1=CC=CC=C1)C(=O)C(=C)C
Filter by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
- Lower prices
- Higher prices
- Lower purities
- Higher purities
- Faster estimated delivery
2-Propenamide, 2-methyl-N-(1-methylethyl)-N-(phenylthioxomethyl)-
CAS:Formula:C14H17NOSMolecular weight:247.3559
