CymitQuimica logo

CAS 88297-20-5

:

Pyridine, 4-(1H-pyrrol-1-ylmethyl)-, compd. with 2,4,6-trinitrophenol(1:1)

Description:
The chemical substance known as "Pyridine, 4-(1H-pyrrol-1-ylmethyl)-, compd. with 2,4,6-trinitrophenol (1:1)" is a complex organic compound characterized by its unique structural features. It consists of a pyridine ring substituted at the 4-position with a pyrrol-1-ylmethyl group, which contributes to its potential biological activity. The compound forms a 1:1 complex with 2,4,6-trinitrophenol, a well-known acidic compound often used in various chemical applications, including as an explosive and in analytical chemistry. The presence of nitro groups in trinitrophenol enhances the compound's reactivity and polarity. This substance may exhibit interesting properties such as solubility in polar solvents and potential applications in pharmaceuticals or materials science. Its CAS number, 88297-20-5, allows for easy identification and reference in chemical databases. As with many organic compounds, safety and handling precautions are essential due to potential toxicity and reactivity, particularly concerning the nitro groups present in the trinitrophenol component.
Formula:C10H10N2C6H3N3O7
InChI:InChI=1S/C10H10N2.C6H3N3O7/c1-2-8-12(7-1)9-10-3-5-11-6-4-10;10-6-4(8(13)14)1-3(7(11)12)2-5(6)9(15)16/h1-8H,9H2;1-2,10H
InChI key:JMWJLDVHXUVABX-UHFFFAOYSA-N
SMILES:C1=CN(C=C1)CC2=CC=NC=C2.C1=C(C=C(C(=C1[N+](=O)[O-])O)[N+](=O)[O-])[N+](=O)[O-]
Found 1 products.