CAS 88298-21-9
:5-Cyclodecen-1-one, 4-methyl-
Description:
5-Cyclodecen-1-one, 4-methyl- is an organic compound characterized by its cyclic structure and unsaturation. It features a cyclodecene ring, which is a ten-membered carbon ring with a double bond, and a ketone functional group at the first position, contributing to its reactivity and potential applications in organic synthesis. The presence of a methyl group at the fourth position introduces a degree of steric hindrance and influences the compound's physical properties, such as boiling point and solubility. This compound is typically colorless to pale yellow and may have a distinctive odor. It is important in various chemical reactions, including those involving electrophilic addition and cycloaddition, due to its unsaturated nature. Additionally, it may serve as an intermediate in the synthesis of more complex organic molecules. Safety data should be consulted for handling and storage, as with any chemical substance, to ensure proper precautions are taken.
Formula:C11H18O
InChI:InChI=1S/C11H18O/c1-10-6-4-2-3-5-7-11(12)9-8-10/h4,6,10H,2-3,5,7-9H2,1H3
InChI key:CPVZTUSHOMAJCO-UHFFFAOYSA-N
SMILES:CC1CCC(=O)CCCCC=C1
Filter by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
- Lower prices
- Higher prices
- Lower purities
- Higher purities
- Faster estimated delivery
