CymitQuimica logo

CAS 883044-72-2

:

2H-1-Benzopyran-2-one, 4-[[2-(1-cyclohexen-1-yl)ethyl]amino]-

Description:
2H-1-Benzopyran-2-one, 4-[[2-(1-cyclohexen-1-yl)ethyl]amino]- is a chemical compound characterized by its complex structure, which includes a benzopyran moiety and an aminoethyl side chain featuring a cyclohexenyl group. This compound is part of a larger class of substances known as flavonoids, which are known for their diverse biological activities, including antioxidant, anti-inflammatory, and potential anticancer properties. The presence of the cyclohexenyl group may influence its reactivity and interaction with biological targets. The compound's molecular structure suggests it may exhibit unique pharmacological effects, making it of interest in medicinal chemistry and drug development. Its CAS number, 883044-72-2, allows for precise identification in chemical databases. As with many organic compounds, its solubility, stability, and reactivity can vary based on environmental conditions and the presence of other substances. Further studies would be necessary to fully elucidate its properties and potential applications in various fields, including pharmaceuticals and agrochemicals.
Formula:C17H19NO2
InChI:InChI=1S/C17H19NO2/c19-17-12-15(14-8-4-5-9-16(14)20-17)18-11-10-13-6-2-1-3-7-13/h4-6,8-9,12,18H,1-3,7,10-11H2
InChI key:FMBDZGARCNLQGH-UHFFFAOYSA-N
SMILES:C1CCC(=CC1)CCNC2=CC(=O)OC3=CC=CC=C32
Found 1 products.