CymitQuimica logo

CAS 88308-22-9

:

2-Propen-1-one,1-[2-[2-hydroxy-3-(propylamino)propoxy]phenyl]-3-phenyl-

Description:
The chemical substance known as "2-Propen-1-one, 1-[2-[2-hydroxy-3-(propylamino)propoxy]phenyl]-3-phenyl-" with CAS number 88308-22-9 is a complex organic compound characterized by its structure, which includes a propenone moiety and multiple functional groups. This compound features a phenyl group and a hydroxy group, indicating potential for hydrogen bonding and reactivity. The presence of a propylamino group suggests that it may exhibit basic properties and could participate in various chemical reactions, such as nucleophilic substitutions. The hydroxy and amino functionalities may enhance its solubility in polar solvents and influence its biological activity. Additionally, the compound's structure implies potential applications in fields such as pharmaceuticals, where it may serve as an intermediate or active ingredient due to its unique chemical properties. Overall, this compound's characteristics, including its reactivity and solubility, make it of interest in both synthetic chemistry and potential therapeutic applications.
Formula:C21H25NO3
InChI:InChI=1S/C21H25NO3/c1-2-14-22-15-18(23)16-25-21-11-7-6-10-19(21)20(24)13-12-17-8-4-3-5-9-17/h3-13,18,22-23H,2,14-16H2,1H3/b13-12+
InChI key:STGHQQSGJSJCGH-OUKQBFOZSA-N
SMILES:CCCNCC(COC1=CC=CC=C1C(=O)/C=C/C2=CC=CC=C2)O
Found 5 products.