CymitQuimica logo

CAS 88309-98-2

:

Carbamic acid, ethenyl-, 2,3-dihydro-2,2-dimethyl-7-benzofuranyl ester

Description:
Carbamic acid, ethenyl-, 2,3-dihydro-2,2-dimethyl-7-benzofuranyl ester, identified by CAS number 88309-98-2, is an organic compound characterized by its unique structure that includes a carbamate functional group and a benzofuran moiety. This compound typically exhibits properties associated with esters, such as being relatively non-polar and having moderate solubility in organic solvents. Its molecular structure suggests potential applications in various fields, including pharmaceuticals and agrochemicals, due to the presence of both the carbamic acid and benzofuran components, which are known for their biological activity. The compound may also display specific reactivity patterns typical of carbamates, such as susceptibility to hydrolysis under certain conditions. Additionally, its stability and behavior in different environments can be influenced by factors such as pH and temperature. Overall, while detailed experimental data may be limited, the characteristics of this compound suggest it could be of interest for further research and application in synthetic chemistry.
Formula:C13H15NO3
InChI:InChI=1S/C13H15NO3/c1-4-14-12(15)16-10-7-5-6-9-8-13(2,3)17-11(9)10/h4-7H,1,8H2,2-3H3,(H,14,15)
InChI key:NNIRWUOXPCPUSK-UHFFFAOYSA-N
SMILES:CC1(CC2=C(O1)C(=CC=C2)OC(=O)NC=C)C
Found 1 products.