CymitQuimica logo

CAS 88310-50-3

:

Carbamic acid, ethenyl-, 2,2-dimethyl-1,3-benzodioxol-4-yl ester

Description:
Carbamic acid, ethenyl-, 2,2-dimethyl-1,3-benzodioxol-4-yl ester, also known by its CAS number 88310-50-3, is an organic compound characterized by its ester functional group derived from carbamic acid and a substituted benzodioxole moiety. This compound typically exhibits a complex structure featuring a benzodioxole ring, which contributes to its potential biological activity and chemical reactivity. The presence of the ethenyl group suggests that it may participate in various chemical reactions, including polymerization or addition reactions. Its unique structure may impart specific properties such as solubility in organic solvents and potential applications in pharmaceuticals or agrochemicals. Additionally, the compound's stability and reactivity can be influenced by the steric effects of the 2,2-dimethyl substituents. As with many organic compounds, safety and handling precautions are essential, as the compound may exhibit toxicity or environmental hazards. Further studies would be necessary to fully elucidate its properties and potential applications in various fields.
Formula:C12H13NO4
InChI:InChI=1S/C12H13NO4/c1-4-13-11(14)15-8-6-5-7-9-10(8)17-12(2,3)16-9/h4-7H,1H2,2-3H3,(H,13,14)
InChI key:MENKVCSUUIDDQJ-UHFFFAOYSA-N
SMILES:CC1(OC2=C(O1)C(=CC=C2)OC(=O)NC=C)C
Found 1 products.