CymitQuimica logo

CAS 883106-60-3

:

4-Piperidinecarboxamide,N-(2-nitrophenyl)-

Description:
4-Piperidinecarboxamide, N-(2-nitrophenyl)-, with the CAS number 883106-60-3, is a chemical compound characterized by its piperidine ring structure, which is a six-membered saturated heterocycle containing one nitrogen atom. This compound features a carboxamide functional group, indicating the presence of a carbonyl group (C=O) directly bonded to a nitrogen atom (N). The presence of the 2-nitrophenyl substituent suggests that there is a nitro group (-NO2) attached to a phenyl ring at the second position, which can influence the compound's reactivity and polarity. Generally, compounds of this nature may exhibit biological activity, making them of interest in medicinal chemistry and drug development. The molecular structure contributes to its potential solubility in organic solvents and its interaction with biological systems. Additionally, the nitro group can enhance the compound's electron-withdrawing properties, which may affect its chemical behavior and interactions in various applications.
Formula:C12H15N3O4
InChI:InChI=1S/C12H15N3O3/c16-12(9-5-7-13-8-6-9)14-10-3-1-2-4-11(10)15(17)18/h1-4,9,13H,5-8H2,(H,14,16)
InChI key:ZPFNXKJEIXQWKK-UHFFFAOYSA-N
SMILES:C1CNCCC1C(=O)NC2=CC=CC=C2[N+](=O)[O-]
Found 1 products.