CymitQuimica logo

CAS 88315-78-0

:

Propanoic acid, 2-methyl-, (10-phenyl-9-anthracenyl)methyl ester

Description:
Propanoic acid, 2-methyl-, (10-phenyl-9-anthracenyl)methyl ester, also known by its CAS number 88315-78-0, is an organic compound characterized by its ester functional group. This compound features a propanoic acid backbone with a methyl group at the second carbon, contributing to its branched structure. The presence of the anthracene moiety, specifically a phenyl group attached to the 10th position, indicates that it has significant aromatic characteristics, which can influence its physical and chemical properties, such as stability and reactivity. Typically, esters like this one exhibit moderate solubility in organic solvents and may have limited solubility in water due to their hydrophobic aromatic components. The compound may also display interesting photophysical properties, making it potentially useful in applications such as organic electronics or as a fluorescent probe. Its synthesis and reactivity can be influenced by the steric and electronic effects of the substituents, which can affect its behavior in various chemical reactions.
Formula:C25H22O2
InChI:InChI=1S/C25H22O2/c1-17(2)25(26)27-16-23-19-12-6-8-14-21(19)24(18-10-4-3-5-11-18)22-15-9-7-13-20(22)23/h3-15,17H,16H2,1-2H3
InChI key:LLARYZMQWIQUQU-UHFFFAOYSA-N
SMILES:CC(C)C(=O)OCC1=C2C=CC=CC2=C(C3=CC=CC=C31)C4=CC=CC=C4
Found 1 products.