CymitQuimica logo

CAS 88317-17-3

:

4(1H)-Pyrimidinone, 1-(4-methoxyphenyl)-2,5,6-triphenyl-

Description:
4(1H)-Pyrimidinone, 1-(4-methoxyphenyl)-2,5,6-triphenyl- is an organic compound characterized by its pyrimidinone core structure, which features a six-membered aromatic ring containing nitrogen atoms. This compound exhibits a complex molecular architecture due to the presence of multiple phenyl groups and a methoxy substituent, contributing to its potential for diverse chemical reactivity and biological activity. The methoxy group enhances the compound's lipophilicity, potentially influencing its solubility and interaction with biological targets. The triphenyl substituents may impart significant steric hindrance, affecting the compound's conformation and reactivity. Additionally, the presence of the pyrimidinone moiety suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, as pyrimidine derivatives are known for their roles in various biological processes. Overall, this compound's unique structural features may lead to interesting properties and applications in fields such as drug discovery and materials science.
Formula:C29H22N2O2
InChI:InChI=1S/C29H22N2O2/c1-33-25-19-17-24(18-20-25)31-27(22-13-7-3-8-14-22)26(21-11-5-2-6-12-21)29(32)30-28(31)23-15-9-4-10-16-23/h2-20H,1H3
InChI key:NFPFUPGZXIUFFL-UHFFFAOYSA-N
SMILES:COC1=CC=C(C=C1)N2C(=C(C(=O)N=C2C3=CC=CC=C3)C4=CC=CC=C4)C5=CC=CC=C5
Found 1 products.