CAS 88317-62-8
:4(1H)-Pyrimidinethione, 2-methyl-6-(methylthio)-
Description:
4(1H)-Pyrimidinethione, 2-methyl-6-(methylthio)-, with the CAS number 88317-62-8, is a heterocyclic organic compound characterized by a pyrimidine ring that contains both a thione functional group and methylthio substituents. This compound typically exhibits properties associated with thiones, such as potential reactivity in nucleophilic substitution reactions due to the presence of the sulfur atom. The methyl groups contribute to its hydrophobic character, influencing its solubility in organic solvents. The presence of the thione group may also impart unique biological activities, making it of interest in medicinal chemistry. Additionally, the compound's structure suggests potential for interactions with biological targets, which could be explored for pharmacological applications. Its synthesis and characterization would involve standard organic chemistry techniques, and it may be utilized in various research contexts, including studies on sulfur-containing heterocycles and their derivatives. Overall, this compound exemplifies the diverse chemistry of pyrimidine derivatives and their potential utility in various fields.
Formula:C6H8N2S2
InChI:InChI=1S/C6H8N2S2/c1-4-7-5(9)3-6(8-4)10-2/h3H,1-2H3,(H,7,8,9)
InChI key:BMYWXMVDLXVRQA-UHFFFAOYSA-N
SMILES:CC1=NC(=CC(=S)N1)SC
Filter by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
- Lower prices
- Higher prices
- Lower purities
- Higher purities
- Faster estimated delivery
