CAS 88320-74-5
:1,3,5-Triazine-2,4,6-triamine, bis(2-ethylhexyl)-
Description:
1,3,5-Triazine-2,4,6-triamine, bis(2-ethylhexyl)-, commonly known as a derivative of melamine, is an organic compound characterized by its triazine ring structure, which consists of three nitrogen atoms and three carbon atoms. This compound features three amine groups, contributing to its potential as a versatile building block in various chemical applications, particularly in the synthesis of resins and polymers. The presence of the bis(2-ethylhexyl) substituent enhances its hydrophobic properties, making it suitable for use in formulations requiring improved solubility in organic solvents. Additionally, this compound exhibits thermal stability and resistance to degradation, which are advantageous in high-performance materials. Its applications may extend to the fields of agriculture, where it can be utilized as a slow-release nitrogen fertilizer, and in the production of flame retardants due to its nitrogen-rich structure. Safety data should be consulted to understand its handling and potential environmental impacts, as with any chemical substance.
Formula:C19H38N6
InChI:InChI=1S/C19H38N6/c1-5-9-11-15(7-3)13-25(14-16(8-4)12-10-6-2)19-23-17(20)22-18(21)24-19/h15-16H,5-14H2,1-4H3,(H4,20,21,22,23,24)
InChI key:ANCYKCBMVRGHGY-UHFFFAOYSA-N
SMILES:CCCCC(CC)CN(CC(CC)CCCC)C1=NC(=NC(=N1)N)N
Filter by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
- Lower prices
- Higher prices
- Lower purities
- Higher purities
- Faster estimated delivery
