CymitQuimica logo

CAS 88321-13-5

:

1-Propanol, 3-(trifluorosilyl)-, carbonate (2:1)

Description:
1-Propanol, 3-(trifluorosilyl)-, carbonate (2:1) is a chemical compound characterized by its unique structure that includes a propanol backbone and a carbonate functional group, along with a trifluorosilyl substituent. This compound typically exhibits properties associated with both alcohols and carbonates, such as being a polar solvent and having potential reactivity due to the presence of the carbonate moiety. The trifluorosilyl group enhances its stability and may impart unique electronic properties, making it useful in various applications, including as a reagent in organic synthesis or in materials science. Its molecular structure suggests it may have low volatility and moderate solubility in organic solvents. Safety data indicates that, like many organofluorine compounds, it should be handled with care due to potential toxicity and environmental concerns. Overall, 1-Propanol, 3-(trifluorosilyl)-, carbonate (2:1) is a specialized compound with applications that leverage its distinctive chemical characteristics.
Formula:C7H12F6O3Si2
InChI:InChI=1S/2C3H7F3OSi.CH2O3/c2*4-8(5,6)3-1-2-7;2-1(3)4/h2*7H,1-3H2;(H2,2,3,4)
InChI key:PAKMSWFNEURWGO-UHFFFAOYSA-N
SMILES:C(CO)C[Si](F)(F)F.C(CO)C[Si](F)(F)F.C(=O)(O)O
Found 1 products.