CAS 88321-59-9
:Pyridine, 3-[phenyl(2-propenyloxy)methyl]-
Description:
Pyridine, 3-[phenyl(2-propenyloxy)methyl]- is an organic compound characterized by its pyridine ring, which is a six-membered aromatic heterocycle containing one nitrogen atom. This compound features a phenyl group attached to a 2-propenyloxy methyl substituent, contributing to its unique chemical properties. Pyridine derivatives are known for their basicity and ability to participate in various chemical reactions, including nucleophilic substitutions and electrophilic aromatic substitutions. The presence of the propenyloxy group introduces potential for further reactivity, making it useful in synthetic organic chemistry. Additionally, compounds like this may exhibit biological activity, which can be explored for pharmaceutical applications. The molecular structure influences its solubility, stability, and interaction with other substances, making it relevant in both industrial and research contexts. Safety data should be consulted for handling and usage, as with all chemical substances, to ensure proper precautions are taken.
Formula:C15H15NO
InChI:InChI=1S/C15H15NO/c1-2-11-17-15(13-7-4-3-5-8-13)14-9-6-10-16-12-14/h2-10,12,15H,1,11H2
InChI key:YRJKIPMQCQOYSL-UHFFFAOYSA-N
SMILES:C=CCOC(C1=CC=CC=C1)C2=CN=CC=C2
Filter by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
- Lower prices
- Higher prices
- Lower purities
- Higher purities
- Faster estimated delivery
