CAS 88326-57-2
:3-Cyclopentene-1,1-dicarboxylicacid, 1,1-bis(1,1-dimethylethyl) ester
Description:
3-Cyclopentene-1,1-dicarboxylic acid, 1,1-bis(1,1-dimethylethyl) ester, identified by CAS number 88326-57-2, is an organic compound characterized by its unique structure, which includes a cyclopentene ring and two carboxylic acid functional groups esterified with tert-butyl groups. This compound typically exhibits properties associated with esters, such as lower boiling points compared to their corresponding acids and a tendency to be less polar, which can influence its solubility in various organic solvents. The presence of the cyclopentene moiety may impart some degree of reactivity, particularly in cycloaddition reactions or as a potential monomer in polymer synthesis. Additionally, the bulky tert-butyl groups can provide steric hindrance, affecting the compound's reactivity and interactions with other molecules. Overall, this compound may find applications in organic synthesis, materials science, or as an intermediate in the production of more complex chemical entities.
Formula:C15H24O4
InChI:InChI=1S/C15H24O4/c1-13(2,3)18-11(16)15(9-7-8-10-15)12(17)19-14(4,5)6/h7-8H,9-10H2,1-6H3
InChI key:NPWLRVQIBOAITL-UHFFFAOYSA-N
SMILES:CC(C)(C)OC(=O)C1(CC=CC1)C(=O)OC(C)(C)C
Synonyms:- 3-Cyclopentene-1,1-dicarboxylicacid, bis(1,1-dimethylethyl) ester (9CI)
Filter by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
- Lower prices
- Higher prices
- Lower purities
- Higher purities
- Faster estimated delivery
3-Cyclopentene-1,1-dicarboxylicacid, 1,1-bis(1,1-dimethylethyl) ester
CAS:Formula:C15H24O4Molecular weight:268.3487
