CymitQuimica logo

CAS 883267-70-7

:

2-(2,4,5-Trifluorophenyl)ethanol

Description:
2-(2,4,5-Trifluorophenyl)ethanol is an organic compound characterized by its structure, which features a phenolic group substituted with three fluorine atoms at the 2, 4, and 5 positions of the aromatic ring, along with an ethanol moiety. This compound is typically a colorless to pale yellow liquid or solid, depending on its purity and temperature. It exhibits moderate polarity due to the presence of the hydroxyl (-OH) group, which can engage in hydrogen bonding, influencing its solubility in various solvents. The trifluoromethyl groups contribute to its unique electronic properties, potentially enhancing its reactivity and making it useful in various chemical syntheses and applications, including pharmaceuticals and agrochemicals. Additionally, the presence of fluorine atoms often imparts increased stability and lipophilicity, which can affect the compound's biological activity and interaction with other molecules. Safety data should be consulted for handling and storage, as fluorinated compounds can exhibit specific hazards.
Formula:C8H7F3O
InChI:InChI=1/C8H7F3O/c9-6-4-8(11)7(10)3-5(6)1-2-12/h3-4,12H,1-2H2
InChI key:KHFXXIXHSGJQOW-UHFFFAOYSA-N
SMILES:C(CO)c1cc(c(cc1F)F)F
Synonyms:
  • Q2R Bf Df Ef
Found 4 products.