CAS 88327-70-2
:2-Butanone, 4-(hexahydropyrrolo[1,2-a]pyrazin-2(1H)-yl)-
Description:
2-Butanone, 4-(hexahydropyrrolo[1,2-a]pyrazin-2(1H)-yl)-, identified by CAS number 88327-70-2, is a chemical compound that features a butanone moiety substituted with a hexahydropyrrolo[1,2-a]pyrazin-2(1H)-yl group. This compound is characterized by its ketone functional group, which contributes to its reactivity and potential applications in organic synthesis. The presence of the hexahydropyrrolo structure suggests that it may exhibit unique properties, such as specific steric and electronic characteristics, which could influence its behavior in chemical reactions and interactions with biological systems. Typically, compounds of this nature may be investigated for their potential use in pharmaceuticals or as intermediates in chemical synthesis. Additionally, the molecular structure may impart certain physical properties, such as solubility and boiling point, which are important for practical applications. As with many organic compounds, safety and handling considerations are essential, particularly regarding toxicity and environmental impact.
Formula:C11H20N2O
InChI:InChI=1S/C11H20N2O/c1-10(14)4-6-12-7-8-13-5-2-3-11(13)9-12/h11H,2-9H2,1H3
InChI key:WJLRBAYOGUEISD-UHFFFAOYSA-N
SMILES:CC(=O)CCN1CCN2CCCC2C1
Filter by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
- Lower prices
- Higher prices
- Lower purities
- Higher purities
- Faster estimated delivery
2-Butanone, 4-(hexahydropyrrolo[1,2-a]pyrazin-2(1H)-yl)-
CAS:Formula:C11H20N2OMolecular weight:196.2893
