CymitQuimica logo

CAS 883290-89-9

:

5-nitro-1H-indazole-7-carboxylic acid

Description:
5-Nitro-1H-indazole-7-carboxylic acid is a chemical compound characterized by its indazole core, which is a bicyclic structure containing a five-membered ring fused to a six-membered ring. The presence of a nitro group at the 5-position and a carboxylic acid group at the 7-position contributes to its chemical reactivity and potential biological activity. This compound is typically a solid at room temperature and is soluble in polar solvents due to the carboxylic acid functionality. It may exhibit acidic properties, allowing it to participate in various chemical reactions, such as esterification or amidation. The nitro group can also serve as a site for further chemical modifications. 5-Nitro-1H-indazole-7-carboxylic acid is of interest in medicinal chemistry and research due to its potential applications in drug development and as a biochemical probe. Its specific interactions and effects in biological systems would require further investigation through experimental studies.
Formula:C8H5N3O4
InChI:InChI=1/C8H5N3O4/c12-8(13)6-2-5(11(14)15)1-4-3-9-10-7(4)6/h1-3H,(H,9,10)(H,12,13)
InChI key:NQJHZWSGEIJEDP-UHFFFAOYSA-N
SMILES:c1c2cn[nH]c2c(cc1N(=O)=O)C(=O)O
Synonyms:
  • 1H-indazole-7-carboxylic acid, 5-nitro-
Found 5 products.