CymitQuimica logo

CAS 883547-73-7

:

1-(Trifluoromethylcyclopropyl)benzene

Description:
1-(Trifluoromethylcyclopropyl)benzene is an organic compound characterized by the presence of a trifluoromethyl group and a cyclopropyl group attached to a benzene ring. The trifluoromethyl group (-CF3) is known for its strong electron-withdrawing properties, which can significantly influence the reactivity and stability of the compound. The cyclopropyl group, a three-membered carbon ring, introduces unique strain and steric effects that can affect the compound's chemical behavior. This substance is typically colorless and may be volatile, depending on its specific structure and conditions. It is primarily of interest in the field of medicinal chemistry and materials science, where its unique properties can be exploited for the development of pharmaceuticals or advanced materials. Additionally, the presence of fluorine atoms often enhances the lipophilicity and metabolic stability of compounds, making them valuable in drug design. Safety data should be consulted for handling and usage, as fluorinated compounds can exhibit specific toxicological profiles.
Formula:C10H9F3
InChI:InChI=1S/C10H9F3/c11-10(12,13)9(6-7-9)8-4-2-1-3-5-8/h1-5H,6-7H2
InChI key:RBZAHILDWCBKFX-UHFFFAOYSA-N
SMILES:C1CC1(C2=CC=CC=C2)C(F)(F)F
Found 3 products.