CymitQuimica logo

CAS 88394-06-3

:

2-Pyrazinecarboxamide,3,4-dihydro-6-methyl-3-oxo-

Description:
2-Pyrazinecarboxamide, 3,4-dihydro-6-methyl-3-oxo- is a chemical compound characterized by its pyrazine ring structure, which is a six-membered aromatic ring containing two nitrogen atoms at non-adjacent positions. This compound features a carboxamide functional group, contributing to its potential as a polar molecule, which can engage in hydrogen bonding. The presence of the 3,4-dihydro structure indicates that it has a saturated portion, which can influence its reactivity and stability. The methyl group at the 6-position adds to the compound's hydrophobic character, potentially affecting its solubility in various solvents. The oxo group signifies the presence of a carbonyl, which can participate in various chemical reactions, including nucleophilic attacks. Overall, this compound may exhibit biological activity, making it of interest in pharmaceutical research, particularly in the development of new therapeutic agents. Its specific properties, such as melting point, boiling point, and solubility, would need to be determined experimentally or sourced from reliable chemical databases.
Formula:C6H7N3O2
InChI:InChI=1S/C6H7N3O2/c1-3-2-8-6(11)4(9-3)5(7)10/h2H,1H3,(H2,7,10)(H,8,11)
InChI key:WUPAWCXFTGKASP-UHFFFAOYSA-N
SMILES:CC1=CNC(=O)C(=N1)C(=O)N
Synonyms:
  • Pyrazinecarboxamide,3,4-dihydro-6-methyl-3-oxo- (9CI)
  • Pyrazinecarboxamide, 3-hydroxy-6-methyl-(7CI)
Found 4 products.